C15H22F3N3O2 — CID 159131728
(2S,6R)-2,6-dimethyl-1-(2,2,2-trifluoroethyl)piperazine;N-hydroxybenzamide (PubChem CID 159131728) has the molecular formula C15H22F3N3O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-1-(2,2,2-trifluoroethyl)piperazine;N-hydroxybenzamide.
| Compound Name | (2S,6R)-2,6-dimethyl-1-(2,2,2-trifluoroethyl)piperazine;N-hydroxybenzamide |
|---|---|
| PubChem CID | 159131728 |
| Molecular Formula | C15H22F3N3O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-1-(2,2,2-trifluoroethyl)piperazine;N-hydroxybenzamide |
| SMILES | C[C@@H]1CNC[C@H](C)N1CC(F)(F)F.O=C(NO)c1ccccc1 |
| InChI | InChI=1S/C8H15F3N2.C7H7NO2/c1-6-3-12-4-7(2)13(6)5-8(9,10)11;9-7(8-10)6-4-2-1-3-5-6/h6-7,12H,3-5H2,1-2H3;1-5,10H,(H,8,9)/t6-,7+; |
| InChIKey | KGZCSSJNTHDXLM-UKMDXRBESA-N |
| XLogP | 2.04 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|