C14H18F3N3O3S — CID 119970062
4-(2-methylpiperazin-1-yl)sulfonyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 119970062) has the molecular formula C14H18F3N3O3S and a molecular weight of 365.38 g/mol. Its IUPAC name is 4-(2-methylpiperazin-1-yl)sulfonyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-(2-methylpiperazin-1-yl)sulfonyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 119970062 |
| Molecular Formula | C14H18F3N3O3S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 4-(2-methylpiperazin-1-yl)sulfonyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC1CNCCN1S(=O)(=O)c1ccc(C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18F3N3O3S/c1-10-8-18-6-7-20(10)24(22,23)12-4-2-11(3-5-12)13(21)19-9-14(15,16)17/h2-5,10,18H,6-9H2,1H3,(H,19,21) |
| InChIKey | BFTDSSIXYFTTBL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |