C9H15F5N2 — CID 144741571
2,6-dimethyl-1-(2,2,3,3,3-pentafluoropropyl)piperazine (PubChem CID 144741571) has the molecular formula C9H15F5N2 and a molecular weight of 246.22 g/mol. Its IUPAC name is 2,6-dimethyl-1-(2,2,3,3,3-pentafluoropropyl)piperazine.
| Compound Name | 2,6-dimethyl-1-(2,2,3,3,3-pentafluoropropyl)piperazine |
|---|---|
| PubChem CID | 144741571 |
| Molecular Formula | C9H15F5N2 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2,6-dimethyl-1-(2,2,3,3,3-pentafluoropropyl)piperazine |
| SMILES | CC1CNCC(C)N1CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H15F5N2/c1-6-3-15-4-7(2)16(6)5-8(10,11)9(12,13)14/h6-7,15H,3-5H2,1-2H3 |
| InChIKey | ILROLPSZQCSKDN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|