C16H23NO3 — CID 58982163
N-hydroxy-6,6-dimethyl-7-(4-methylphenyl)-7-oxoheptanamide (PubChem CID 58982163) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is N-hydroxy-6,6-dimethyl-7-(4-methylphenyl)-7-oxoheptanamide.
| Compound Name | N-hydroxy-6,6-dimethyl-7-(4-methylphenyl)-7-oxoheptanamide |
|---|---|
| PubChem CID | 58982163 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N-hydroxy-6,6-dimethyl-7-(4-methylphenyl)-7-oxoheptanamide |
| SMILES | Cc1ccc(C(=O)C(C)(C)CCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C16H23NO3/c1-12-7-9-13(10-8-12)15(19)16(2,3)11-5-4-6-14(18)17-20/h7-10,20H,4-6,11H2,1-3H3,(H,17,18) |
| InChIKey | GXGYUSFBLKAFOX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|