C17H23NO3 — CID 174266948
N-[2-(4-methylphenyl)propan-2-yl]-6,7-dioxoheptanamide (PubChem CID 174266948) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[2-(4-methylphenyl)propan-2-yl]-6,7-dioxoheptanamide.
| Compound Name | N-[2-(4-methylphenyl)propan-2-yl]-6,7-dioxoheptanamide |
|---|---|
| PubChem CID | 174266948 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[2-(4-methylphenyl)propan-2-yl]-6,7-dioxoheptanamide |
| SMILES | Cc1ccc(C(C)(C)NC(=O)CCCCC(=O)C=O)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-13-8-10-14(11-9-13)17(2,3)18-16(21)7-5-4-6-15(20)12-19/h8-12H,4-7H2,1-3H3,(H,18,21) |
| InChIKey | ZCJMAUXQVWRXLZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|