C21H23NO3 — CID 23503045
N,6-dihydroxy-6-[4-[2-(4-methylphenyl)ethynyl]phenyl]hexanamide (PubChem CID 23503045) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is N,6-dihydroxy-6-[4-[2-(4-methylphenyl)ethynyl]phenyl]hexanamide.
| Compound Name | N,6-dihydroxy-6-[4-[2-(4-methylphenyl)ethynyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 23503045 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N,6-dihydroxy-6-[4-[2-(4-methylphenyl)ethynyl]phenyl]hexanamide |
| SMILES | Cc1ccc(C#Cc2ccc(C(O)CCCCC(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-16-6-8-17(9-7-16)10-11-18-12-14-19(15-13-18)20(23)4-2-3-5-21(24)22-25/h6-9,12-15,20,23,25H,2-5H2,1H3,(H,22,24) |
| InChIKey | JATYSFLYNFFUID-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|