C18H23NO3 — CID 11044829
N,8-dihydroxy-8-naphthalen-2-yloctanamide (PubChem CID 11044829) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is N,8-dihydroxy-8-naphthalen-2-yloctanamide.
| Compound Name | N,8-dihydroxy-8-naphthalen-2-yloctanamide |
|---|---|
| PubChem CID | 11044829 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N,8-dihydroxy-8-naphthalen-2-yloctanamide |
| SMILES | O=C(CCCCCCC(O)c1ccc2ccccc2c1)NO |
| InChI | InChI=1S/C18H23NO3/c20-17(9-3-1-2-4-10-18(21)19-22)16-12-11-14-7-5-6-8-15(14)13-16/h5-8,11-13,17,20,22H,1-4,9-10H2,(H,19,21) |
| InChIKey | JWCSCYWHCCHTEF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|