C19H29NO3 — CID 23503080
6-(4-cycloheptylphenyl)-N,6-dihydroxyhexanamide (PubChem CID 23503080) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 6-(4-cycloheptylphenyl)-N,6-dihydroxyhexanamide.
| Compound Name | 6-(4-cycloheptylphenyl)-N,6-dihydroxyhexanamide |
|---|---|
| PubChem CID | 23503080 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 6-(4-cycloheptylphenyl)-N,6-dihydroxyhexanamide |
| SMILES | O=C(CCCCC(O)c1ccc(C2CCCCCC2)cc1)NO |
| InChI | InChI=1S/C19H29NO3/c21-18(9-5-6-10-19(22)20-23)17-13-11-16(12-14-17)15-7-3-1-2-4-8-15/h11-15,18,21,23H,1-10H2,(H,20,22) |
| InChIKey | IQBSPKBWBKGHET-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|