C25H31NO4S — CID 18346009
(6R)-6-hydroxy-N-(2-methoxypropan-2-yloxy)-6-[4-[2-(4-methylsulfanylphenyl)ethynyl]phenyl]hexanamide (PubChem CID 18346009) has the molecular formula C25H31NO4S and a molecular weight of 441.59 g/mol. Its IUPAC name is (6R)-6-hydroxy-N-(2-methoxypropan-2-yloxy)-6-[4-[2-(4-methylsulfanylphenyl)ethynyl]phenyl]hexanamide.
| Compound Name | (6R)-6-hydroxy-N-(2-methoxypropan-2-yloxy)-6-[4-[2-(4-methylsulfanylphenyl)ethynyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 18346009 |
| Molecular Formula | C25H31NO4S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | (6R)-6-hydroxy-N-(2-methoxypropan-2-yloxy)-6-[4-[2-(4-methylsulfanylphenyl)ethynyl]phenyl]hexanamide |
| SMILES | COC(C)(C)ONC(=O)CCCC[C@@H](O)c1ccc(C#Cc2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C25H31NO4S/c1-25(2,29-3)30-26-24(28)8-6-5-7-23(27)21-15-11-19(12-16-21)9-10-20-13-17-22(31-4)18-14-20/h11-18,23,27H,5-8H2,1-4H3,(H,26,28)/t23-/m1/s1 |
| InChIKey | YZMJLRDLFKXWSA-HSZRJFAPSA-N |
| XLogP | 4.83 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|