C16H23NO6S — CID 87527089
N-hydroxy-7-(4-methoxyphenyl)-6-methyl-6-methylsulfonyl-7-oxoheptanamide (PubChem CID 87527089) has the molecular formula C16H23NO6S and a molecular weight of 357.43 g/mol. Its IUPAC name is N-hydroxy-7-(4-methoxyphenyl)-6-methyl-6-methylsulfonyl-7-oxoheptanamide.
| Compound Name | N-hydroxy-7-(4-methoxyphenyl)-6-methyl-6-methylsulfonyl-7-oxoheptanamide |
|---|---|
| PubChem CID | 87527089 |
| Molecular Formula | C16H23NO6S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-hydroxy-7-(4-methoxyphenyl)-6-methyl-6-methylsulfonyl-7-oxoheptanamide |
| SMILES | COc1ccc(C(=O)C(C)(CCCCC(=O)NO)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H23NO6S/c1-16(24(3,21)22,11-5-4-6-14(18)17-20)15(19)12-7-9-13(23-2)10-8-12/h7-10,20H,4-6,11H2,1-3H3,(H,17,18) |
| InChIKey | DMKZPFYPNRJVFD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|