C18H18CaN6O6S2 — CID 57349684
CID 57349684 (PubChem CID 57349684) has the molecular formula C18H18CaN6O6S2 and a molecular weight of 518.59 g/mol.
| Compound Name | CID 57349684 |
|---|---|
| PubChem CID | 57349684 |
| Molecular Formula | C18H18CaN6O6S2 |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | — |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NC#N)cc1.CC(=O)Nc1ccc(S(=O)(=O)NC#N)cc1.[Ca] |
| InChI | InChI=1S/2C9H9N3O3S.Ca/c2*1-7(13)12-8-2-4-9(5-3-8)16(14,15)11-6-10;/h2*2-5,11H,1H3,(H,12,13); |
| InChIKey | SVEJXATWBBIDGB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 198.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|