C11H12N4O3S2 — CID 106399440
4-(1,2,4-oxadiazol-3-ylmethylsulfamoylmethyl)benzenecarbothioamide (PubChem CID 106399440) has the molecular formula C11H12N4O3S2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 4-(1,2,4-oxadiazol-3-ylmethylsulfamoylmethyl)benzenecarbothioamide.
| Compound Name | 4-(1,2,4-oxadiazol-3-ylmethylsulfamoylmethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 106399440 |
| Molecular Formula | C11H12N4O3S2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-(1,2,4-oxadiazol-3-ylmethylsulfamoylmethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(CS(=O)(=O)NCc2ncon2)cc1 |
| InChI | InChI=1S/C11H12N4O3S2/c12-11(19)9-3-1-8(2-4-9)6-20(16,17)14-5-10-13-7-18-15-10/h1-4,7,14H,5-6H2,(H2,12,19) |
| InChIKey | TYSNBMLEKMHCJF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|