4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid

C11H12N4O2 — CID 65347630

IUPAC4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid
SMILESO=C(O)c1ccc(CNCc2ncn[nH]2)cc1
InChIInChI=1S/C11H12N4O2/c16-11(17)9-3-1-8(2-4-9)5-12-6-10-13-7-14-15-10/h1-4,7,12H,5-6H2,(H,16,17)(H,13,14,15)
InChIKeyNOMUURHSOFWYIL-UHFFFAOYSA-N
MW232.24 g/mol
LogP0.79
Rot. Bonds5

About 4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid

4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid (PubChem CID 65347630) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid.

Molecular Properties

Compound Name4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid
PubChem CID65347630
Molecular FormulaC11H12N4O2
Molecular Weight232.24 g/mol
Exact Mass232.10
IUPAC Name4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid
SMILESO=C(O)c1ccc(CNCc2ncn[nH]2)cc1
InChIInChI=1S/C11H12N4O2/c16-11(17)9-3-1-8(2-4-9)5-12-6-10-13-7-14-15-10/h1-4,7,12H,5-6H2,(H,16,17)(H,13,14,15)
InChIKeyNOMUURHSOFWYIL-UHFFFAOYSA-N
XLogP0.79
TPSA90.90 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.24
LogP ≤ 50.79
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid?
The IUPAC name of 4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid (CID 65347630) is 4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid.
What is the SMILES notation for 4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid?
The canonical SMILES for 4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid is O=C(O)c1ccc(CNCc2ncn[nH]2)cc1.
What is the InChIKey of 4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid?
The InChIKey is NOMUURHSOFWYIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2/c16-11(17)9-3-1-8(2-4-9)5-12-6-10-13-7-14-15-10/h1-4,7,12H,5-6H2,(H,16,17)(H,13,14,15).
What are the key properties of 4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid?
4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid has a molecular weight of 232.24 g/mol, XLogP of 0.79, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]benzoic acid is sourced from PubChem (CID 65347630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).