C12H14N4O2 — CID 114167925
4-[[1-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]benzoic acid (PubChem CID 114167925) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-[[1-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]benzoic acid.
| Compound Name | 4-[[1-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 114167925 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 4-[[1-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]benzoic acid |
| SMILES | CC(NCc1ccc(C(=O)O)cc1)c1ncn[nH]1 |
| InChI | InChI=1S/C12H14N4O2/c1-8(11-14-7-15-16-11)13-6-9-2-4-10(5-3-9)12(17)18/h2-5,7-8,13H,6H2,1H3,(H,17,18)(H,14,15,16) |
| InChIKey | JBXDVIUSUMDVHS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |