C12H22N2O4S2 — CID 106001823
5-(aminomethyl)-N-[3-(2-methoxyethoxy)propyl]-4-methylthiophene-2-sulfonamide (PubChem CID 106001823) has the molecular formula C12H22N2O4S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[3-(2-methoxyethoxy)propyl]-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-[3-(2-methoxyethoxy)propyl]-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106001823 |
| Molecular Formula | C12H22N2O4S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 5-(aminomethyl)-N-[3-(2-methoxyethoxy)propyl]-4-methylthiophene-2-sulfonamide |
| SMILES | COCCOCCCNS(=O)(=O)c1cc(C)c(CN)s1 |
| InChI | InChI=1S/C12H22N2O4S2/c1-10-8-12(19-11(10)9-13)20(15,16)14-4-3-5-18-7-6-17-2/h8,14H,3-7,9,13H2,1-2H3 |
| InChIKey | KXYPWKXXLNUPGA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|