C14H21NO4S — CID 47269188
N-(2,5-dimethylphenyl)sulfonyl-4-ethoxybutanamide (PubChem CID 47269188) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)sulfonyl-4-ethoxybutanamide.
| Compound Name | N-(2,5-dimethylphenyl)sulfonyl-4-ethoxybutanamide |
|---|---|
| PubChem CID | 47269188 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-(2,5-dimethylphenyl)sulfonyl-4-ethoxybutanamide |
| SMILES | CCOCCCC(=O)NS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C14H21NO4S/c1-4-19-9-5-6-14(16)15-20(17,18)13-10-11(2)7-8-12(13)3/h7-8,10H,4-6,9H2,1-3H3,(H,15,16) |
| InChIKey | QIMAEDADKGLAHH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|