C12H14F3NO3S — CID 146129663
N-(2,4-dimethylphenyl)sulfonyl-4,4,4-trifluorobutanamide (PubChem CID 146129663) has the molecular formula C12H14F3NO3S and a molecular weight of 309.31 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)sulfonyl-4,4,4-trifluorobutanamide.
| Compound Name | N-(2,4-dimethylphenyl)sulfonyl-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 146129663 |
| Molecular Formula | C12H14F3NO3S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-(2,4-dimethylphenyl)sulfonyl-4,4,4-trifluorobutanamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)CCC(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C12H14F3NO3S/c1-8-3-4-10(9(2)7-8)20(18,19)16-11(17)5-6-12(13,14)15/h3-4,7H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | OSAJMULHSPZYNL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |