C16H28N4O3S — CID 111043850
1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-(3-ethoxypropyl)guanidine (PubChem CID 111043850) has the molecular formula C16H28N4O3S and a molecular weight of 356.49 g/mol. Its IUPAC name is 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-(3-ethoxypropyl)guanidine.
| Compound Name | 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-(3-ethoxypropyl)guanidine |
|---|---|
| PubChem CID | 111043850 |
| Molecular Formula | C16H28N4O3S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-(3-ethoxypropyl)guanidine |
| SMILES | CCOCCC/N=C(\N)NCCNS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C16H28N4O3S/c1-4-23-11-5-8-18-16(17)19-9-10-20-24(21,22)15-12-13(2)6-7-14(15)3/h6-7,12,20H,4-5,8-11H2,1-3H3,(H3,17,18,19) |
| InChIKey | LXPAEGGPKMVCGT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|