C11H11ClN4O3S2 — CID 24834715
1-(5-chloro-1,3,4-thiadiazol-2-yl)-3-(2,5-dimethylphenyl)sulfonylurea (PubChem CID 24834715) has the molecular formula C11H11ClN4O3S2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 1-(5-chloro-1,3,4-thiadiazol-2-yl)-3-(2,5-dimethylphenyl)sulfonylurea.
| Compound Name | 1-(5-chloro-1,3,4-thiadiazol-2-yl)-3-(2,5-dimethylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 24834715 |
| Molecular Formula | C11H11ClN4O3S2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 1-(5-chloro-1,3,4-thiadiazol-2-yl)-3-(2,5-dimethylphenyl)sulfonylurea |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NC(=O)Nc2nnc(Cl)s2)c1 |
| InChI | InChI=1S/C11H11ClN4O3S2/c1-6-3-4-7(2)8(5-6)21(18,19)16-10(17)13-11-15-14-9(12)20-11/h3-5H,1-2H3,(H2,13,15,16,17) |
| InChIKey | OCXIJLXTBGJQQB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |