C11H11F2NO6S — CID 61144143
(2S)-2-[(3,5-difluorophenyl)sulfonylamino]pentanedioic acid (PubChem CID 61144143) has the molecular formula C11H11F2NO6S and a molecular weight of 323.27 g/mol. Its IUPAC name is (2S)-2-[(3,5-difluorophenyl)sulfonylamino]pentanedioic acid.
| Compound Name | (2S)-2-[(3,5-difluorophenyl)sulfonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 61144143 |
| Molecular Formula | C11H11F2NO6S |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | (2S)-2-[(3,5-difluorophenyl)sulfonylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NS(=O)(=O)c1cc(F)cc(F)c1)C(=O)O |
| InChI | InChI=1S/C11H11F2NO6S/c12-6-3-7(13)5-8(4-6)21(19,20)14-9(11(17)18)1-2-10(15)16/h3-5,9,14H,1-2H2,(H,15,16)(H,17,18)/t9-/m0/s1 |
| InChIKey | RLXXTKQNEDQCSF-VIFPVBQESA-N |
| XLogP | 0.56 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |