C13H17NO5S2 — CID 63243013
N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]-2-methylsulfonylethanesulfonamide (PubChem CID 63243013) has the molecular formula C13H17NO5S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]-2-methylsulfonylethanesulfonamide.
| Compound Name | N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]-2-methylsulfonylethanesulfonamide |
|---|---|
| PubChem CID | 63243013 |
| Molecular Formula | C13H17NO5S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]-2-methylsulfonylethanesulfonamide |
| SMILES | CS(=O)(=O)CCS(=O)(=O)NCc1cccc(C#CCO)c1 |
| InChI | InChI=1S/C13H17NO5S2/c1-20(16,17)8-9-21(18,19)14-11-13-5-2-4-12(10-13)6-3-7-15/h2,4-5,10,14-15H,7-9,11H2,1H3 |
| InChIKey | DYFWFRPQZYQLHT-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|