C27H27N3O — CID 22587985
N-butan-2-yl-2,3-bis(3-methylphenyl)quinoxaline-6-carboxamide (PubChem CID 22587985) has the molecular formula C27H27N3O and a molecular weight of 409.53 g/mol. Its IUPAC name is N-butan-2-yl-2,3-bis(3-methylphenyl)quinoxaline-6-carboxamide.
| Compound Name | N-butan-2-yl-2,3-bis(3-methylphenyl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 22587985 |
| Molecular Formula | C27H27N3O |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | N-butan-2-yl-2,3-bis(3-methylphenyl)quinoxaline-6-carboxamide |
| SMILES | CCC(C)NC(=O)c1ccc2nc(-c3cccc(C)c3)c(-c3cccc(C)c3)nc2c1 |
| InChI | InChI=1S/C27H27N3O/c1-5-19(4)28-27(31)22-12-13-23-24(16-22)30-26(21-11-7-9-18(3)15-21)25(29-23)20-10-6-8-17(2)14-20/h6-16,19H,5H2,1-4H3,(H,28,31) |
| InChIKey | ISSYRWFOFUFUAY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |