C36H38N4O3 — CID 46371796
N-[3-[benzyl(propan-2-yl)amino]propyl]-2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxamide (PubChem CID 46371796) has the molecular formula C36H38N4O3 and a molecular weight of 574.73 g/mol. Its IUPAC name is N-[3-[benzyl(propan-2-yl)amino]propyl]-2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxamide.
| Compound Name | N-[3-[benzyl(propan-2-yl)amino]propyl]-2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 46371796 |
| Molecular Formula | C36H38N4O3 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | N-[3-[benzyl(propan-2-yl)amino]propyl]-2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxamide |
| SMILES | COc1ccc(-c2nc3ccc(C(=O)NCCCN(Cc4ccccc4)C(C)C)cc3nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H38N4O3/c1-25(2)40(24-26-9-6-5-7-10-26)22-8-21-37-36(41)29-15-20-32-33(23-29)39-35(28-13-18-31(43-4)19-14-28)34(38-32)27-11-16-30(42-3)17-12-27/h5-7,9-20,23,25H,8,21-22,24H2,1-4H3,(H,37,41) |
| InChIKey | FHNCMPDGTAWJLO-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|