C29H22N4O3 — CID 5262009
N-(4,5-dimethyl-2-nitrophenyl)-2,3-diphenylquinoxaline-6-carboxamide (PubChem CID 5262009) has the molecular formula C29H22N4O3 and a molecular weight of 474.52 g/mol. Its IUPAC name is N-(4,5-dimethyl-2-nitrophenyl)-2,3-diphenylquinoxaline-6-carboxamide.
| Compound Name | N-(4,5-dimethyl-2-nitrophenyl)-2,3-diphenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 5262009 |
| Molecular Formula | C29H22N4O3 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N-(4,5-dimethyl-2-nitrophenyl)-2,3-diphenylquinoxaline-6-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc3nc(-c4ccccc4)c(-c4ccccc4)nc3c2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C29H22N4O3/c1-18-15-25(26(33(35)36)16-19(18)2)32-29(34)22-13-14-23-24(17-22)31-28(21-11-7-4-8-12-21)27(30-23)20-9-5-3-6-10-20/h3-17H,1-2H3,(H,32,34) |
| InChIKey | UZWRJJAHRIEDRB-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|