C30H22N4OS — CID 43853093
N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-2,3-diphenylquinoxaline-6-carboxamide (PubChem CID 43853093) has the molecular formula C30H22N4OS and a molecular weight of 486.60 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-2,3-diphenylquinoxaline-6-carboxamide.
| Compound Name | N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-2,3-diphenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 43853093 |
| Molecular Formula | C30H22N4OS |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-2,3-diphenylquinoxaline-6-carboxamide |
| SMILES | Cc1ccc2sc(NC(=O)c3ccc4nc(-c5ccccc5)c(-c5ccccc5)nc4c3)nc2c1C |
| InChI | InChI=1S/C30H22N4OS/c1-18-13-16-25-26(19(18)2)33-30(36-25)34-29(35)22-14-15-23-24(17-22)32-28(21-11-7-4-8-12-21)27(31-23)20-9-5-3-6-10-20/h3-17H,1-2H3,(H,33,34,35) |
| InChIKey | JNCYIQRSQBBHMO-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |