C15H19N3O — CID 22588073
N,2,3-triethylquinoxaline-6-carboxamide (PubChem CID 22588073) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is N,2,3-triethylquinoxaline-6-carboxamide.
| Compound Name | N,2,3-triethylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 22588073 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N,2,3-triethylquinoxaline-6-carboxamide |
| SMILES | CCNC(=O)c1ccc2nc(CC)c(CC)nc2c1 |
| InChI | InChI=1S/C15H19N3O/c1-4-11-12(5-2)18-14-9-10(15(19)16-6-3)7-8-13(14)17-11/h7-9H,4-6H2,1-3H3,(H,16,19) |
| InChIKey | VXULFMOENXBSDX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |