C21H21N5O — CID 21008774
N-(1H-benzimidazol-2-ylmethyl)-2,3-diethylquinoxaline-6-carboxamide (PubChem CID 21008774) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-2,3-diethylquinoxaline-6-carboxamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-2,3-diethylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 21008774 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-2,3-diethylquinoxaline-6-carboxamide |
| SMILES | CCc1nc2ccc(C(=O)NCc3nc4ccccc4[nH]3)cc2nc1CC |
| InChI | InChI=1S/C21H21N5O/c1-3-14-15(4-2)24-19-11-13(9-10-18(19)23-14)21(27)22-12-20-25-16-7-5-6-8-17(16)26-20/h5-11H,3-4,12H2,1-2H3,(H,22,27)(H,25,26) |
| InChIKey | YCULNQKZIMYPNJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |