C12H11N4O2PS — CID 54016181
5-(benzoylcarbamothioylamino)-3H-1,3-azaphosphole-4-carboxamide (PubChem CID 54016181) has the molecular formula C12H11N4O2PS and a molecular weight of 306.29 g/mol. Its IUPAC name is 5-(benzoylcarbamothioylamino)-3H-1,3-azaphosphole-4-carboxamide.
| Compound Name | 5-(benzoylcarbamothioylamino)-3H-1,3-azaphosphole-4-carboxamide |
|---|---|
| PubChem CID | 54016181 |
| Molecular Formula | C12H11N4O2PS |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 5-(benzoylcarbamothioylamino)-3H-1,3-azaphosphole-4-carboxamide |
| SMILES | NC(=O)c1[pH]cnc1NC(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H11N4O2PS/c13-9(17)8-10(14-6-19-8)15-12(20)16-11(18)7-4-2-1-3-5-7/h1-6,19H,(H2,13,17)(H2,15,16,18,20) |
| InChIKey | ZFVHWWMSGGWJFG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|