C19H14BN3O2S — CID 89367522
CID 89367522 (PubChem CID 89367522) has the molecular formula C19H14BN3O2S and a molecular weight of 359.22 g/mol.
| Compound Name | CID 89367522 |
|---|---|
| PubChem CID | 89367522 |
| Molecular Formula | C19H14BN3O2S |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(NC(=S)NC(=O)c2ccccc2)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C19H14BN3O2S/c20-14-11-16(25-15-9-5-2-6-10-15)17(21-12-14)22-19(26)23-18(24)13-7-3-1-4-8-13/h1-12H,(H2,21,22,23,24,26) |
| InChIKey | QNGHYCOMPMIRMK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|