C15H17N5O2S — CID 14897142
5-(benzoylcarbamothioylamino)-1-propylimidazole-4-carboxamide (PubChem CID 14897142) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is 5-(benzoylcarbamothioylamino)-1-propylimidazole-4-carboxamide.
| Compound Name | 5-(benzoylcarbamothioylamino)-1-propylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 14897142 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 5-(benzoylcarbamothioylamino)-1-propylimidazole-4-carboxamide |
| SMILES | CCCn1cnc(C(N)=O)c1NC(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H17N5O2S/c1-2-8-20-9-17-11(12(16)21)13(20)18-15(23)19-14(22)10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H2,16,21)(H2,18,19,22,23) |
| InChIKey | ALUGLKCVKRCHSR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|