C20H29N6O5PS — CID 10720071
5-(benzoylcarbamothioylamino)-1-(5-diethoxyphosphorylpentyl)triazole-4-carboxamide (PubChem CID 10720071) has the molecular formula C20H29N6O5PS and a molecular weight of 496.53 g/mol. Its IUPAC name is 5-(benzoylcarbamothioylamino)-1-(5-diethoxyphosphorylpentyl)triazole-4-carboxamide.
| Compound Name | 5-(benzoylcarbamothioylamino)-1-(5-diethoxyphosphorylpentyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 10720071 |
| Molecular Formula | C20H29N6O5PS |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 5-(benzoylcarbamothioylamino)-1-(5-diethoxyphosphorylpentyl)triazole-4-carboxamide |
| SMILES | CCOP(=O)(CCCCCn1nnc(C(N)=O)c1NC(=S)NC(=O)c1ccccc1)OCC |
| InChI | InChI=1S/C20H29N6O5PS/c1-3-30-32(29,31-4-2)14-10-6-9-13-26-18(16(17(21)27)24-25-26)22-20(33)23-19(28)15-11-7-5-8-12-15/h5,7-8,11-12H,3-4,6,9-10,13-14H2,1-2H3,(H2,21,27)(H2,22,23,28,33) |
| InChIKey | UXNUYAMLPRDLEW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 150.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|