C16H17N3O3S2 — CID 1018418
ethyl 5-methyl-2-[(4-methylbenzoyl)carbamothioylamino]-1,3-thiazole-4-carboxylate (PubChem CID 1018418) has the molecular formula C16H17N3O3S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is ethyl 5-methyl-2-[(4-methylbenzoyl)carbamothioylamino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-2-[(4-methylbenzoyl)carbamothioylamino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 1018418 |
| Molecular Formula | C16H17N3O3S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | ethyl 5-methyl-2-[(4-methylbenzoyl)carbamothioylamino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(NC(=S)NC(=O)c2ccc(C)cc2)sc1C |
| InChI | InChI=1S/C16H17N3O3S2/c1-4-22-14(21)12-10(3)24-16(17-12)19-15(23)18-13(20)11-7-5-9(2)6-8-11/h5-8H,4H2,1-3H3,(H2,17,18,19,20,23) |
| InChIKey | QXBQPBUZPWDKGF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|