C16H16ClN3O3S2 — CID 21216325
ethyl 2-[[2-(4-chlorophenyl)acetyl]carbamothioylamino]-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 21216325) has the molecular formula C16H16ClN3O3S2 and a molecular weight of 397.91 g/mol. Its IUPAC name is ethyl 2-[[2-(4-chlorophenyl)acetyl]carbamothioylamino]-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[2-(4-chlorophenyl)acetyl]carbamothioylamino]-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 21216325 |
| Molecular Formula | C16H16ClN3O3S2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | ethyl 2-[[2-(4-chlorophenyl)acetyl]carbamothioylamino]-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(NC(=S)NC(=O)Cc2ccc(Cl)cc2)sc1C |
| InChI | InChI=1S/C16H16ClN3O3S2/c1-3-23-14(22)13-9(2)25-16(19-13)20-15(24)18-12(21)8-10-4-6-11(17)7-5-10/h4-7H,3,8H2,1-2H3,(H2,18,19,20,21,24) |
| InChIKey | ROWBUYALDIBQSL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|