C18H21N — CID 143156717
N-[(E)-1,2-diphenylethenyl]butan-1-amine (PubChem CID 143156717) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is N-[(E)-1,2-diphenylethenyl]butan-1-amine.
| Compound Name | N-[(E)-1,2-diphenylethenyl]butan-1-amine |
|---|---|
| PubChem CID | 143156717 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-[(E)-1,2-diphenylethenyl]butan-1-amine |
| SMILES | CCCCN/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21N/c1-2-3-14-19-18(17-12-8-5-9-13-17)15-16-10-6-4-7-11-16/h4-13,15,19H,2-3,14H2,1H3/b18-15+ |
| InChIKey | TXRXMOSOSAPYAY-OBGWFSINSA-N |
| XLogP | 4.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|