C14H18N2O4 — CID 88801983
N-butyl-2-oxo-2-phenylacetamide;2-oxoacetamide (PubChem CID 88801983) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-butyl-2-oxo-2-phenylacetamide;2-oxoacetamide.
| Compound Name | N-butyl-2-oxo-2-phenylacetamide;2-oxoacetamide |
|---|---|
| PubChem CID | 88801983 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-butyl-2-oxo-2-phenylacetamide;2-oxoacetamide |
| SMILES | CCCCNC(=O)C(=O)c1ccccc1.NC(=O)C=O |
| InChI | InChI=1S/C12H15NO2.C2H3NO2/c1-2-3-9-13-12(15)11(14)10-7-5-4-6-8-10;3-2(5)1-4/h4-8H,2-3,9H2,1H3,(H,13,15);1H,(H2,3,5) |
| InChIKey | LMFZZNKUANTBEW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|