C19H24N2 — CID 177442927
(E)-1-N-butyl-1-N'-(4-methylphenyl)-2-phenylethene-1,1-diamine (PubChem CID 177442927) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is (E)-1-N-butyl-1-N'-(4-methylphenyl)-2-phenylethene-1,1-diamine.
| Compound Name | (E)-1-N-butyl-1-N'-(4-methylphenyl)-2-phenylethene-1,1-diamine |
|---|---|
| PubChem CID | 177442927 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (E)-1-N-butyl-1-N'-(4-methylphenyl)-2-phenylethene-1,1-diamine |
| SMILES | CCCCN/C(=C\c1ccccc1)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C19H24N2/c1-3-4-14-20-19(15-17-8-6-5-7-9-17)21-18-12-10-16(2)11-13-18/h5-13,15,20-21H,3-4,14H2,1-2H3/b19-15+ |
| InChIKey | PANTVFDIJNRHSL-XDJHFCHBSA-N |
| XLogP | 4.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|