C18H22N2 — CID 177403210
(E)-1-N-butyl-1-N',2-diphenylethene-1,1-diamine (PubChem CID 177403210) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is (E)-1-N-butyl-1-N',2-diphenylethene-1,1-diamine.
| Compound Name | (E)-1-N-butyl-1-N',2-diphenylethene-1,1-diamine |
|---|---|
| PubChem CID | 177403210 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | (E)-1-N-butyl-1-N',2-diphenylethene-1,1-diamine |
| SMILES | CCCCN/C(=C\c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C18H22N2/c1-2-3-14-19-18(15-16-10-6-4-7-11-16)20-17-12-8-5-9-13-17/h4-13,15,19-20H,2-3,14H2,1H3/b18-15+ |
| InChIKey | VGCNRSHDTZASNY-OBGWFSINSA-N |
| XLogP | 4.49 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|