C16H21NO3 — CID 143243546
N-[(Z)-2-(5,5-dimethyl-1,3-dioxan-2-yl)-1-phenylethenyl]acetamide (PubChem CID 143243546) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[(Z)-2-(5,5-dimethyl-1,3-dioxan-2-yl)-1-phenylethenyl]acetamide.
| Compound Name | N-[(Z)-2-(5,5-dimethyl-1,3-dioxan-2-yl)-1-phenylethenyl]acetamide |
|---|---|
| PubChem CID | 143243546 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-[(Z)-2-(5,5-dimethyl-1,3-dioxan-2-yl)-1-phenylethenyl]acetamide |
| SMILES | CC(=O)N/C(=C\C1OCC(C)(C)CO1)c1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c1-12(18)17-14(13-7-5-4-6-8-13)9-15-19-10-16(2,3)11-20-15/h4-9,15H,10-11H2,1-3H3,(H,17,18)/b14-9- |
| InChIKey | YTTUTERENXCECA-ZROIWOOFSA-N |
| XLogP | 2.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |