C24H19FO2 — CID 166439926
methyl (2E,4E)-2-(2-fluorophenyl)-4,5-diphenylpenta-2,4-dienoate (PubChem CID 166439926) has the molecular formula C24H19FO2 and a molecular weight of 358.41 g/mol. Its IUPAC name is methyl (2E,4E)-2-(2-fluorophenyl)-4,5-diphenylpenta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-2-(2-fluorophenyl)-4,5-diphenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 166439926 |
| Molecular Formula | C24H19FO2 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | methyl (2E,4E)-2-(2-fluorophenyl)-4,5-diphenylpenta-2,4-dienoate |
| SMILES | COC(=O)/C(=C/C(=C\c1ccccc1)c1ccccc1)c1ccccc1F |
| InChI | InChI=1S/C24H19FO2/c1-27-24(26)22(21-14-8-9-15-23(21)25)17-20(19-12-6-3-7-13-19)16-18-10-4-2-5-11-18/h2-17H,1H3/b20-16+,22-17+ |
| InChIKey | WXOATQMXJQSAPW-DWBJUFKYSA-N |
| XLogP | 5.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|