C13H16ClNO4S — CID 107650781
ethyl (E)-3-[4-(2-chloroethylsulfonylamino)phenyl]prop-2-enoate (PubChem CID 107650781) has the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. Its IUPAC name is ethyl (E)-3-[4-(2-chloroethylsulfonylamino)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(2-chloroethylsulfonylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 107650781 |
| Molecular Formula | C13H16ClNO4S |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | ethyl (E)-3-[4-(2-chloroethylsulfonylamino)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NS(=O)(=O)CCCl)cc1 |
| InChI | InChI=1S/C13H16ClNO4S/c1-2-19-13(16)8-5-11-3-6-12(7-4-11)15-20(17,18)10-9-14/h3-8,15H,2,9-10H2,1H3/b8-5+ |
| InChIKey | YZIUOCHSMYGVTA-VMPITWQZSA-N |
| XLogP | 2.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|