C21H25NO4S — CID 75421839
ethyl (E)-3-[4-[(2,6-diethylphenyl)sulfamoyl]phenyl]prop-2-enoate (PubChem CID 75421839) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(2,6-diethylphenyl)sulfamoyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(2,6-diethylphenyl)sulfamoyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 75421839 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | ethyl (E)-3-[4-[(2,6-diethylphenyl)sulfamoyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(S(=O)(=O)Nc2c(CC)cccc2CC)cc1 |
| InChI | InChI=1S/C21H25NO4S/c1-4-17-8-7-9-18(5-2)21(17)22-27(24,25)19-13-10-16(11-14-19)12-15-20(23)26-6-3/h7-15,22H,4-6H2,1-3H3/b15-12+ |
| InChIKey | BRAXPOANJZZWOT-NTCAYCPXSA-N |
| XLogP | 4.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|