C19H23N3O6S — CID 91941794
ethyl 3-[4-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)sulfamoyl]phenyl]prop-2-enoate (PubChem CID 91941794) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is ethyl 3-[4-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)sulfamoyl]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)sulfamoyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91941794 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | ethyl 3-[4-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)sulfamoyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(S(=O)(=O)NN2C(=O)NC3(CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C19H23N3O6S/c1-2-28-16(23)11-8-14-6-9-15(10-7-14)29(26,27)21-22-17(24)19(20-18(22)25)12-4-3-5-13-19/h6-11,21H,2-5,12-13H2,1H3,(H,20,25) |
| InChIKey | HQRVOGCPRIRANQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|