C21H30N4O5S — CID 24537070
3-[(4-tert-butylphenyl)sulfonylamino]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide (PubChem CID 24537070) has the molecular formula C21H30N4O5S and a molecular weight of 450.56 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)sulfonylamino]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide.
| Compound Name | 3-[(4-tert-butylphenyl)sulfonylamino]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide |
|---|---|
| PubChem CID | 24537070 |
| Molecular Formula | C21H30N4O5S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 3-[(4-tert-butylphenyl)sulfonylamino]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)NN2C(=O)NC3(CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C21H30N4O5S/c1-20(2,3)15-7-9-16(10-8-15)31(29,30)22-14-11-17(26)24-25-18(27)21(23-19(25)28)12-5-4-6-13-21/h7-10,22H,4-6,11-14H2,1-3H3,(H,23,28)(H,24,26) |
| InChIKey | KMVMQGVMGMUAFT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|