C16H23N5O5 — CID 18162292
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 18162292) has the molecular formula C16H23N5O5 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 18162292 |
| Molecular Formula | C16H23N5O5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | CN1CC(=O)N(CCCC(=O)NN2C(=O)NC3(CCCCC3)C2=O)C1=O |
| InChI | InChI=1S/C16H23N5O5/c1-19-10-12(23)20(15(19)26)9-5-6-11(22)18-21-13(24)16(17-14(21)25)7-3-2-4-8-16/h2-10H2,1H3,(H,17,25)(H,18,22) |
| InChIKey | QHDQCAGNGARQPB-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|