C19H23F3N4O6S — CID 24545871
N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanamide (PubChem CID 24545871) has the molecular formula C19H23F3N4O6S and a molecular weight of 492.48 g/mol. Its IUPAC name is N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanamide.
| Compound Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 24545871 |
| Molecular Formula | C19H23F3N4O6S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)CCNS(=O)(=O)c1ccc(OC(F)(F)F)cc1)C2=O |
| InChI | InChI=1S/C19H23F3N4O6S/c1-12-6-9-18(10-7-12)16(28)26(17(29)24-18)25-15(27)8-11-23-33(30,31)14-4-2-13(3-5-14)32-19(20,21)22/h2-5,12,23H,6-11H2,1H3,(H,24,29)(H,25,27) |
| InChIKey | OMCLXCKFGKMMNI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|