C21H24N4O5S — CID 27533515
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(naphthalen-2-ylsulfonylamino)propanamide (PubChem CID 27533515) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(naphthalen-2-ylsulfonylamino)propanamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(naphthalen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 27533515 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-3-(naphthalen-2-ylsulfonylamino)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2ccccc2c1)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C21H24N4O5S/c26-18(24-25-19(27)21(23-20(25)28)11-4-1-5-12-21)10-13-22-31(29,30)17-9-8-15-6-2-3-7-16(15)14-17/h2-3,6-9,14,22H,1,4-5,10-13H2,(H,23,28)(H,24,26) |
| InChIKey | DYPGZELJOINVRZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|