C20H29N3O5S — CID 56558538
3-[(4-tert-butylphenyl)sulfonylamino]-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]propanamide (PubChem CID 56558538) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)sulfonylamino]-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]propanamide.
| Compound Name | 3-[(4-tert-butylphenyl)sulfonylamino]-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 56558538 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-[(4-tert-butylphenyl)sulfonylamino]-N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]propanamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)NCCCN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C20H29N3O5S/c1-20(2,3)15-5-7-16(8-6-15)29(27,28)22-13-11-17(24)21-12-4-14-23-18(25)9-10-19(23)26/h5-8,22H,4,9-14H2,1-3H3,(H,21,24) |
| InChIKey | BNZOIIGRYHBFSY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|