C22H25FN2O3S — CID 60611163
3-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl)-N-(4-fluorophenyl)-4-methylbenzenesulfonamide (PubChem CID 60611163) has the molecular formula C22H25FN2O3S and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl)-N-(4-fluorophenyl)-4-methylbenzenesulfonamide.
| Compound Name | 3-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl)-N-(4-fluorophenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 60611163 |
| Molecular Formula | C22H25FN2O3S |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 3-(2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl)-N-(4-fluorophenyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1C(=O)N1CCC2CCCCC21 |
| InChI | InChI=1S/C22H25FN2O3S/c1-15-6-11-19(29(27,28)24-18-9-7-17(23)8-10-18)14-20(15)22(26)25-13-12-16-4-2-3-5-21(16)25/h6-11,14,16,21,24H,2-5,12-13H2,1H3 |
| InChIKey | LORUIPLONPTPKT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |