C20H20ClN3O4 — CID 143217290
3-[5-[4-[(2-chloroacetyl)-methylamino]phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid;ethane (PubChem CID 143217290) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is 3-[5-[4-[(2-chloroacetyl)-methylamino]phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid;ethane.
| Compound Name | 3-[5-[4-[(2-chloroacetyl)-methylamino]phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid;ethane |
|---|---|
| PubChem CID | 143217290 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3-[5-[4-[(2-chloroacetyl)-methylamino]phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid;ethane |
| SMILES | CC.CN(C(=O)CCl)c1ccc(-c2nnc(-c3cccc(C(=O)O)c3)o2)cc1 |
| InChI | InChI=1S/C18H14ClN3O4.C2H6/c1-22(15(23)10-19)14-7-5-11(6-8-14)16-20-21-17(26-16)12-3-2-4-13(9-12)18(24)25;1-2/h2-9H,10H2,1H3,(H,24,25);1-2H3 |
| InChIKey | PKHCLDKSCSDCQH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|