C22H17N3O5S — CID 67057123
4-[5-[3-(4-methyl-N-sulfinoanilino)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid (PubChem CID 67057123) has the molecular formula C22H17N3O5S and a molecular weight of 435.46 g/mol. Its IUPAC name is 4-[5-[3-(4-methyl-N-sulfinoanilino)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid.
| Compound Name | 4-[5-[3-(4-methyl-N-sulfinoanilino)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 67057123 |
| Molecular Formula | C22H17N3O5S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 4-[5-[3-(4-methyl-N-sulfinoanilino)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid |
| SMILES | Cc1ccc(N(c2cccc(-c3nnc(-c4ccc(C(=O)O)cc4)o3)c2)S(=O)O)cc1 |
| InChI | InChI=1S/C22H17N3O5S/c1-14-5-11-18(12-6-14)25(31(28)29)19-4-2-3-17(13-19)21-24-23-20(30-21)15-7-9-16(10-8-15)22(26)27/h2-13H,1H3,(H,26,27)(H,28,29) |
| InChIKey | GFCUNYGJRDIIEW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|